raaeraae22
raaeraae22
04-02-2017
Chemistry
contestada
When is di- used in the name of a hydrocarbon?
Respuesta :
DoctorCass
DoctorCass
04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link
VER TODAS LAS RESPUESTAS ( 98+ )
Otras preguntas
What was the main purpose of the continental congress
The passage of the USA Patriot Act of 2001 and the creation of the Department of Homeland Security reflect the determination of the United States government to
why did foreign powers treat the vs goverment under the rticles of confederation with scorn
42 At standard pressure, the total amount of heat required to completely vaporize a 100. gram sample of water at its boiling point is(1) 2.26 X 10 J (3) 2.26 X
48 When an atom of the unstable isotope Na-24 decays, it becomes an atom of Mg-24 because the Na-24 atom spontaneously releases(1) an alpha particle (3) a neutr
A 6-pack of undershirts cost 13.98.This is 3.96 less then the cost of buying 6 individual shirts.If each undershirt costs the same amount how much does each und
The data collected from a laboratory titration are used to calculate the (1) rate of a chemical reaction (2) heat of a chemical reaction (3) concentration of a
A 16-mile race is made up of 3 equal sections. Which equation shows how to find the number of miles in each section?
Which statement best expresses the philosophy of humanism? (1) God selects those to be saved. (2) The pope expresses the ultimate word of God. (3) People have p
What was the Berlin Airlift? a. a successful attack by the Western Allies on the city of Berlin during World War II b. a successful plan by the Western Allies
